Ige Antibody Laboratories manufactures the increased ige antibodies reagents distributed by Genprice. The Increased Ige Antibodies reagent is RUO (Research Use Only) to test human serum or cell culture lab samples. To purchase these products, for the MSDS, Data Sheet, protocol, storage conditions/temperature or for the concentration, please contact ige antibody. Other Increased products are available in stock. Specificity: Increased Category: Ige Group: Antibodies
True Blue |
|
TargetMol Chemicals |
1mg |
Ask for price |
- SMILES: N=C(C1=CC=C(OC(/C=C/C2=CC3=CC(C(N)=N)=CC=C3O2)=C4)C4=C1)N.Cl.Cl
- Formula: C20H18Cl2N4O2
|
|
Description: True Blue |
True Blue |
|
TargetMol Chemicals |
50mg |
Ask for price |
- SMILES: N=C(C1=CC=C(OC(/C=C/C2=CC3=CC(C(N)=N)=CC=C3O2)=C4)C4=C1)N.Cl.Cl
- Formula: C20H18Cl2N4O2
|
|
Description: True Blue |
True Blue |
|
TargetMol Chemicals |
5mg |
Ask for price |
- SMILES: N=C(C1=CC=C(OC(/C=C/C2=CC3=CC(C(N)=N)=CC=C3O2)=C4)C4=C1)N.Cl.Cl
- Formula: C20H18Cl2N4O2
|
|
Description: True Blue |
JBS True Blue |
|
MiTeGen |
300 µl |
EUR 16 |
|
Description: JBS True Blue |
IgE Antibody |
|
GenWay Biotech |
1 mg |
Ask for price |
- IgE Antibody was previously known under catalogue number 20-511-241290 was previously known under catalogue number 20-511-241290
|
Antibodies information
Postmeiotic Segregation Increased 2 (PMS2) (PT2116) Antibody |
|
N1752-50uL |
Assay Biotech |
50uL |
EUR 66.5 |
|
Description: Human Postmeiotic Segregation Increased 2 (PMS2) (PT2116) Mouse Monoclonal Antibody |
PMS2L5, CT (PMS2P5, PMS2L5, PMS4, PMS7, Postmeiotic segregation increased 2-like protein 5, Postmeiotic segregation increased protein 4, Postmeiotic segregation increased protein 7, Putative postmeiotic segregation increased 2 pseudogene 5) (Biotin) |
|
MBS6335226-02mL |
MyBiosource |
0.2mL |
EUR 980 |
PMS2L5, CT (PMS2P5, PMS2L5, PMS4, PMS7, Postmeiotic segregation increased 2-like protein 5, Postmeiotic segregation increased protein 4, Postmeiotic segregation increased protein 7, Putative postmeiotic segregation increased 2 pseudogene 5) (Biotin) |
|
MBS6335226-5x02mL |
MyBiosource |
5x0.2mL |
EUR 4250 |
PMS2L5, CT (PMS2P5, PMS2L5, PMS4, PMS7, Postmeiotic segregation increased 2-like protein 5, Postmeiotic segregation increased protein 4, Postmeiotic segregation increased protein 7, Putative postmeiotic segregation increased 2 pseudogene 5) (Azide free) ( |
|
MBS6335228-02mL |
MyBiosource |
0.2mL |
EUR 980 |
PMS2L5, CT (PMS2P5, PMS2L5, PMS4, PMS7, Postmeiotic segregation increased 2-like protein 5, Postmeiotic segregation increased protein 4, Postmeiotic segregation increased protein 7, Putative postmeiotic segregation increased 2 pseudogene 5) (Azide free) ( |
|
MBS6335228-5x02mL |
MyBiosource |
5x0.2mL |
EUR 4250 |
PMS2L5, CT (PMS2P5, PMS2L5, PMS4, PMS7, Postmeiotic segregation increased 2-like protein 5, Postmeiotic segregation increased protein 4, Postmeiotic segregation increased protein 7, Putative postmeiotic segregation increased 2 pseudogene 5) (MaxLight 405) |
|
MBS6335229-01mL |
MyBiosource |
0.1mL |
EUR 980 |
PMS2L5, CT (PMS2P5, PMS2L5, PMS4, PMS7, Postmeiotic segregation increased 2-like protein 5, Postmeiotic segregation increased protein 4, Postmeiotic segregation increased protein 7, Putative postmeiotic segregation increased 2 pseudogene 5) (MaxLight 405) |
|
MBS6335229-5x01mL |
MyBiosource |
5x0.1mL |
EUR 4250 |
PMS2L5, CT (PMS2P5, PMS2L5, PMS4, PMS7, Postmeiotic segregation increased 2-like protein 5, Postmeiotic segregation increased protein 4, Postmeiotic segregation increased protein 7, Putative postmeiotic segregation increased 2 pseudogene 5) (MaxLight 490) |
|
MBS6335230-01mL |
MyBiosource |
0.1mL |
EUR 980 |
PMS2L5, CT (PMS2P5, PMS2L5, PMS4, PMS7, Postmeiotic segregation increased 2-like protein 5, Postmeiotic segregation increased protein 4, Postmeiotic segregation increased protein 7, Putative postmeiotic segregation increased 2 pseudogene 5) (MaxLight 490) |
|
MBS6335230-5x01mL |
MyBiosource |
5x0.1mL |
EUR 4250 |
PMS2L5, CT (PMS2P5, PMS2L5, PMS4, PMS7, Postmeiotic segregation increased 2-like protein 5, Postmeiotic segregation increased protein 4, Postmeiotic segregation increased protein 7, Putative postmeiotic segregation increased 2 pseudogene 5) (MaxLight 550) |
|
MBS6335231-01mL |
MyBiosource |
0.1mL |
EUR 980 |
PMS2L5, CT (PMS2P5, PMS2L5, PMS4, PMS7, Postmeiotic segregation increased 2-like protein 5, Postmeiotic segregation increased protein 4, Postmeiotic segregation increased protein 7, Putative postmeiotic segregation increased 2 pseudogene 5) (MaxLight 550) |
|
MBS6335231-5x01mL |
MyBiosource |
5x0.1mL |
EUR 4250 |
PMS2L5, CT (PMS2P5, PMS2L5, PMS4, PMS7, Postmeiotic segregation increased 2-like protein 5, Postmeiotic segregation increased protein 4, Postmeiotic segregation increased protein 7, Putative postmeiotic segregation increased 2 pseudogene 5) (MaxLight 650) |
|
MBS6335232-01mL |
MyBiosource |
0.1mL |
EUR 980 |
PMS2L5, CT (PMS2P5, PMS2L5, PMS4, PMS7, Postmeiotic segregation increased 2-like protein 5, Postmeiotic segregation increased protein 4, Postmeiotic segregation increased protein 7, Putative postmeiotic segregation increased 2 pseudogene 5) (MaxLight 650) |
|
MBS6335232-5x01mL |
MyBiosource |
5x0.1mL |
EUR 4250 |
PMS2L5, CT (PMS2P5, PMS2L5, PMS4, PMS7, Postmeiotic segregation increased 2-like protein 5, Postmeiotic segregation increased protein 4, Postmeiotic segregation increased protein 7, Putative postmeiotic segregation increased 2 pseudogene 5) (MaxLight 750) |
|
MBS6335233-01mL |
MyBiosource |
0.1mL |
EUR 980 |
PMS2L5, CT (PMS2P5, PMS2L5, PMS4, PMS7, Postmeiotic segregation increased 2-like protein 5, Postmeiotic segregation increased protein 4, Postmeiotic segregation increased protein 7, Putative postmeiotic segregation increased 2 pseudogene 5) (MaxLight 750) |
|
MBS6335233-5x01mL |
MyBiosource |
5x0.1mL |
EUR 4250 |
PMS2 (Postmeiotic Segregation Increased 2) |
|
MBS556114-01mL |
MyBiosource |
0.1mL |
EUR 455 |
PMS2 (Postmeiotic Segregation Increased 2) |
|
MBS556114-5x01mL |
MyBiosource |
5x0.1mL |
EUR 1895 |